C19H17FN4O2S — CID 7145882
N-(4-fluorophenyl)-2-[[2-(2-methylquinazolin-4-yl)sulfanylacetyl]amino]acetamide (PubChem CID 7145882) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[2-(2-methylquinazolin-4-yl)sulfanylacetyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[2-(2-methylquinazolin-4-yl)sulfanylacetyl]amino]acetamide |
|---|---|
| PubChem CID | 7145882 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[2-(2-methylquinazolin-4-yl)sulfanylacetyl]amino]acetamide |
| SMILES | Cc1nc(SCC(=O)NCC(=O)Nc2ccc(F)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C19H17FN4O2S/c1-12-22-16-5-3-2-4-15(16)19(23-12)27-11-18(26)21-10-17(25)24-14-8-6-13(20)7-9-14/h2-9H,10-11H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | QBBRAGCEIJYHGR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |