C12H8Cl3NOS2 — CID 71459026
(NZ)-N-[2-(4-chlorophenyl)sulfanyl-1-(2,5-dichlorothiophen-3-yl)ethylidene]hydroxylamine (PubChem CID 71459026) has the molecular formula C12H8Cl3NOS2 and a molecular weight of 352.70 g/mol. Its IUPAC name is (NZ)-N-[2-(4-chlorophenyl)sulfanyl-1-(2,5-dichlorothiophen-3-yl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-(4-chlorophenyl)sulfanyl-1-(2,5-dichlorothiophen-3-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 71459026 |
| Molecular Formula | C12H8Cl3NOS2 |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 350.91 |
| IUPAC Name | (NZ)-N-[2-(4-chlorophenyl)sulfanyl-1-(2,5-dichlorothiophen-3-yl)ethylidene]hydroxylamine |
| SMILES | O/N=C(\CSc1ccc(Cl)cc1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H8Cl3NOS2/c13-7-1-3-8(4-2-7)18-6-10(16-17)9-5-11(14)19-12(9)15/h1-5,17H,6H2/b16-10+ |
| InChIKey | OHAVFLXUFMEEAN-MHWRWJLKSA-N |
| XLogP | 5.68 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|