C20H18ClN3O4S — CID 71459050
1-(4-chlorophenyl)-3-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]thiourea (PubChem CID 71459050) has the molecular formula C20H18ClN3O4S and a molecular weight of 431.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]thiourea |
|---|---|
| PubChem CID | 71459050 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]thiourea |
| SMILES | Cc1c(C)c2ccc(OCC(=O)NNC(=S)Nc3ccc(Cl)cc3)cc2oc1=O |
| InChI | InChI=1S/C20H18ClN3O4S/c1-11-12(2)19(26)28-17-9-15(7-8-16(11)17)27-10-18(25)23-24-20(29)22-14-5-3-13(21)4-6-14/h3-9H,10H2,1-2H3,(H,23,25)(H2,22,24,29) |
| InChIKey | NJAKMIAVABQRLK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|