C20H22BrN5OS — CID 71459200
8-[(4-aminocyclohexyl)amino]-5-bromo-N-(thiophen-2-ylmethyl)-1,6-naphthyridine-7-carboxamide (PubChem CID 71459200) has the molecular formula C20H22BrN5OS and a molecular weight of 460.40 g/mol. Its IUPAC name is 8-[(4-aminocyclohexyl)amino]-5-bromo-N-(thiophen-2-ylmethyl)-1,6-naphthyridine-7-carboxamide.
| Compound Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-(thiophen-2-ylmethyl)-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 71459200 |
| Molecular Formula | C20H22BrN5OS |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-(thiophen-2-ylmethyl)-1,6-naphthyridine-7-carboxamide |
| SMILES | NC1CCC(Nc2c(C(=O)NCc3cccs3)nc(Br)c3cccnc23)CC1 |
| InChI | InChI=1S/C20H22BrN5OS/c21-19-15-4-1-9-23-16(15)17(25-13-7-5-12(22)6-8-13)18(26-19)20(27)24-11-14-3-2-10-28-14/h1-4,9-10,12-13,25H,5-8,11,22H2,(H,24,27) |
| InChIKey | NBKCZNFIBFDFBC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|