C26H26BrN5O — CID 71527588
8-[(4-aminocyclohexyl)amino]-5-bromo-N-(naphthalen-1-ylmethyl)-1,6-naphthyridine-7-carboxamide (PubChem CID 71527588) has the molecular formula C26H26BrN5O and a molecular weight of 504.43 g/mol. Its IUPAC name is 8-[(4-aminocyclohexyl)amino]-5-bromo-N-(naphthalen-1-ylmethyl)-1,6-naphthyridine-7-carboxamide.
| Compound Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-(naphthalen-1-ylmethyl)-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 71527588 |
| Molecular Formula | C26H26BrN5O |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-(naphthalen-1-ylmethyl)-1,6-naphthyridine-7-carboxamide |
| SMILES | NC1CCC(Nc2c(C(=O)NCc3cccc4ccccc34)nc(Br)c3cccnc23)CC1 |
| InChI | InChI=1S/C26H26BrN5O/c27-25-21-9-4-14-29-22(21)23(31-19-12-10-18(28)11-13-19)24(32-25)26(33)30-15-17-7-3-6-16-5-1-2-8-20(16)17/h1-9,14,18-19,31H,10-13,15,28H2,(H,30,33) |
| InChIKey | KZAZNPUVGLIFCC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|