C28H38BrN5O2Si — CID 45376979
8-[(4-aminocyclohexyl)amino]-5-bromo-N-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-1,6-naphthyridine-7-carboxamide (PubChem CID 45376979) has the molecular formula C28H38BrN5O2Si and a molecular weight of 584.64 g/mol. Its IUPAC name is 8-[(4-aminocyclohexyl)amino]-5-bromo-N-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-1,6-naphthyridine-7-carboxamide.
| Compound Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 45376979 |
| Molecular Formula | C28H38BrN5O2Si |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-1,6-naphthyridine-7-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CNC(=O)c2nc(Br)c3cccnc3c2NC2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C28H38BrN5O2Si/c1-28(2,3)37(4,5)36-21-14-8-18(9-15-21)17-32-27(35)25-24(33-20-12-10-19(30)11-13-20)23-22(26(29)34-25)7-6-16-31-23/h6-9,14-16,19-20,33H,10-13,17,30H2,1-5H3,(H,32,35) |
| InChIKey | VCVVVBSYQXLIJF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|