C20H21BrFN5O2S — CID 143966540
5-bromo-N-[(4-fluorophenyl)methyl]-8-[3-(methanesulfinamido)propylamino]-1,6-naphthyridine-7-carboxamide (PubChem CID 143966540) has the molecular formula C20H21BrFN5O2S and a molecular weight of 494.39 g/mol. Its IUPAC name is 5-bromo-N-[(4-fluorophenyl)methyl]-8-[3-(methanesulfinamido)propylamino]-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-bromo-N-[(4-fluorophenyl)methyl]-8-[3-(methanesulfinamido)propylamino]-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 143966540 |
| Molecular Formula | C20H21BrFN5O2S |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 5-bromo-N-[(4-fluorophenyl)methyl]-8-[3-(methanesulfinamido)propylamino]-1,6-naphthyridine-7-carboxamide |
| SMILES | CS(=O)NCCCNc1c(C(=O)NCc2ccc(F)cc2)nc(Br)c2cccnc12 |
| InChI | InChI=1S/C20H21BrFN5O2S/c1-30(29)26-11-3-10-24-17-16-15(4-2-9-23-16)19(21)27-18(17)20(28)25-12-13-5-7-14(22)8-6-13/h2,4-9,24,26H,3,10-12H2,1H3,(H,25,28) |
| InChIKey | WWIJSCXZVPJDMM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|