C23H25BrClN5O2 — CID 45376840
8-[(4-aminocyclohexyl)amino]-5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-1,6-naphthyridine-7-carboxamide (PubChem CID 45376840) has the molecular formula C23H25BrClN5O2 and a molecular weight of 518.84 g/mol. Its IUPAC name is 8-[(4-aminocyclohexyl)amino]-5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-1,6-naphthyridine-7-carboxamide.
| Compound Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 45376840 |
| Molecular Formula | C23H25BrClN5O2 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 8-[(4-aminocyclohexyl)amino]-5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-1,6-naphthyridine-7-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2nc(Br)c3cccnc3c2NC2CCC(N)CC2)cc1Cl |
| InChI | InChI=1S/C23H25BrClN5O2/c1-32-18-9-4-13(11-17(18)25)12-28-23(31)21-20(29-15-7-5-14(26)6-8-15)19-16(22(24)30-21)3-2-10-27-19/h2-4,9-11,14-15,29H,5-8,12,26H2,1H3,(H,28,31) |
| InChIKey | SUAWLTUNMIOQFT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|