C28H35BrN4O2 — CID 143966541
5-bromo-N-[(4-cyclohexyloxyphenyl)methyl]-8-(hexylamino)-1,6-naphthyridine-7-carboxamide (PubChem CID 143966541) has the molecular formula C28H35BrN4O2 and a molecular weight of 539.52 g/mol. Its IUPAC name is 5-bromo-N-[(4-cyclohexyloxyphenyl)methyl]-8-(hexylamino)-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-bromo-N-[(4-cyclohexyloxyphenyl)methyl]-8-(hexylamino)-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 143966541 |
| Molecular Formula | C28H35BrN4O2 |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 5-bromo-N-[(4-cyclohexyloxyphenyl)methyl]-8-(hexylamino)-1,6-naphthyridine-7-carboxamide |
| SMILES | CCCCCCNc1c(C(=O)NCc2ccc(OC3CCCCC3)cc2)nc(Br)c2cccnc12 |
| InChI | InChI=1S/C28H35BrN4O2/c1-2-3-4-8-17-31-25-24-23(12-9-18-30-24)27(29)33-26(25)28(34)32-19-20-13-15-22(16-14-20)35-21-10-6-5-7-11-21/h9,12-16,18,21,31H,2-8,10-11,17,19H2,1H3,(H,32,34) |
| InChIKey | BUOOHNKKIAKQAZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|