C35H36ClN5O4 — CID 71459344
(E)-3-[4-[[(3S)-3-[[2-(5-chloro-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71459344) has the molecular formula C35H36ClN5O4 and a molecular weight of 626.16 g/mol. Its IUPAC name is (E)-3-[4-[[(3S)-3-[[2-(5-chloro-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(3S)-3-[[2-(5-chloro-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71459344 |
| Molecular Formula | C35H36ClN5O4 |
| Molecular Weight | 626.16 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (E)-3-[4-[[(3S)-3-[[2-(5-chloro-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN1CC[C@@](NC(=O)c2ccc3c(C4CCCC4)c(-c4ccc(Cl)cn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)C1 |
| InChI | InChI=1S/C35H36ClN5O4/c1-40-18-17-35(21-40,34(45)38-26-12-7-22(8-13-26)9-16-30(42)43)39-33(44)24-10-14-27-29(19-24)41(2)32(28-15-11-25(36)20-37-28)31(27)23-5-3-4-6-23/h7-16,19-20,23H,3-6,17-18,21H2,1-2H3,(H,38,45)(H,39,44)(H,42,43)/b16-9+/t35-/m0/s1 |
| InChIKey | FBUJIEQJALEKGO-QHFHFLNUSA-N |
| XLogP | 6.09 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.16 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|