C11H11BrN6OS — CID 71459449
N-[(E)-(2-bromophenyl)methylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 71459449) has the molecular formula C11H11BrN6OS and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[(E)-(2-bromophenyl)methylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(2-bromophenyl)methylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 71459449 |
| Molecular Formula | C11H11BrN6OS |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | N-[(E)-(2-bromophenyl)methylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nnnc1SCC(=O)N/N=C/c1ccccc1Br |
| InChI | InChI=1S/C11H11BrN6OS/c1-18-11(15-16-17-18)20-7-10(19)14-13-6-8-4-2-3-5-9(8)12/h2-6H,7H2,1H3,(H,14,19)/b13-6+ |
| InChIKey | GBXZCORXLOMMEW-AWNIVKPZSA-N |
| XLogP | 1.22 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|