C15H23N3O3S — CID 71459519
(2S)-N-hydroxy-4-methylsulfanyl-2-(3-phenylpropylcarbamoylamino)butanamide (PubChem CID 71459519) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is (2S)-N-hydroxy-4-methylsulfanyl-2-(3-phenylpropylcarbamoylamino)butanamide.
| Compound Name | (2S)-N-hydroxy-4-methylsulfanyl-2-(3-phenylpropylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 71459519 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2S)-N-hydroxy-4-methylsulfanyl-2-(3-phenylpropylcarbamoylamino)butanamide |
| SMILES | CSCC[C@H](NC(=O)NCCCc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C15H23N3O3S/c1-22-11-9-13(14(19)18-21)17-15(20)16-10-5-8-12-6-3-2-4-7-12/h2-4,6-7,13,21H,5,8-11H2,1H3,(H,18,19)(H2,16,17,20)/t13-/m0/s1 |
| InChIKey | IZGAXQJRVCSBKK-ZDUSSCGKSA-N |
| XLogP | 1.55 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|