C33H34O17 — CID 71460054
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 71460054) has the molecular formula C33H34O17 and a molecular weight of 702.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71460054 |
| Molecular Formula | C33H34O17 |
| Molecular Weight | 702.62 g/mol |
| Exact Mass | 702.18 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc2c(=O)c(-c3cc(OC)c4c(c3OC)OCO4)coc2cc1OC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H34O17/c1-14(34)42-12-25-29(46-15(2)35)31(47-16(3)36)32(48-17(4)37)33(50-25)49-23-10-21-19(9-22(23)39-5)26(38)20(11-43-21)18-8-24(40-6)28-30(27(18)41-7)45-13-44-28/h8-11,25,29,31-33H,12-13H2,1-7H3/t25-,29-,31+,32-,33?/m1/s1 |
| InChIKey | FZMZKGCOVXYPAW-XODNAZTOSA-N |
| XLogP | 2.68 |
| TPSA | 200.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|