C26H29N2O3+ — CID 71462191
N-(2-acetylphenyl)-4-(6-pyridin-1-ium-1-ylhexoxy)benzamide (PubChem CID 71462191) has the molecular formula C26H29N2O3+ and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(2-acetylphenyl)-4-(6-pyridin-1-ium-1-ylhexoxy)benzamide.
| Compound Name | N-(2-acetylphenyl)-4-(6-pyridin-1-ium-1-ylhexoxy)benzamide |
|---|---|
| PubChem CID | 71462191 |
| Molecular Formula | C26H29N2O3+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-(2-acetylphenyl)-4-(6-pyridin-1-ium-1-ylhexoxy)benzamide |
| SMILES | CC(=O)c1ccccc1NC(=O)c1ccc(OCCCCCC[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-21(29)24-11-5-6-12-25(24)27-26(30)22-13-15-23(16-14-22)31-20-10-3-2-7-17-28-18-8-4-9-19-28/h4-6,8-9,11-16,18-19H,2-3,7,10,17,20H2,1H3/p+1 |
| InChIKey | PVVPGZPDJJVPBD-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|