C14H19NO4 — CID 71466310
(2,5-dioxopyrrolidin-1-yl) 2-[(3Z)-cyclooct-3-en-1-yl]acetate (PubChem CID 71466310) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(3Z)-cyclooct-3-en-1-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3Z)-cyclooct-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 71466310 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3Z)-cyclooct-3-en-1-yl]acetate |
| SMILES | O=C(CC1C/C=C\CCCC1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H19NO4/c16-12-8-9-13(17)15(12)19-14(18)10-11-6-4-2-1-3-5-7-11/h2,4,11H,1,3,5-10H2/b4-2- |
| InChIKey | LHUZRHNWUUGZLZ-RQOWECAXSA-N |
| XLogP | 2.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|