C33H43N2O8P — CID 71467747
1-O-ethyl 4-O-methyl 2-[bis(2,6-dimethylphenoxy)phosphorylamino]-3-(4-methoxyanilino)-2-propylbutanedioate (PubChem CID 71467747) has the molecular formula C33H43N2O8P and a molecular weight of 626.69 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl 2-[bis(2,6-dimethylphenoxy)phosphorylamino]-3-(4-methoxyanilino)-2-propylbutanedioate.
| Compound Name | 1-O-ethyl 4-O-methyl 2-[bis(2,6-dimethylphenoxy)phosphorylamino]-3-(4-methoxyanilino)-2-propylbutanedioate |
|---|---|
| PubChem CID | 71467747 |
| Molecular Formula | C33H43N2O8P |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 1-O-ethyl 4-O-methyl 2-[bis(2,6-dimethylphenoxy)phosphorylamino]-3-(4-methoxyanilino)-2-propylbutanedioate |
| SMILES | CCCC(NP(=O)(Oc1c(C)cccc1C)Oc1c(C)cccc1C)(C(=O)OCC)C(Nc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C33H43N2O8P/c1-9-21-33(32(37)41-10-2,30(31(36)40-8)34-26-17-19-27(39-7)20-18-26)35-44(38,42-28-22(3)13-11-14-23(28)4)43-29-24(5)15-12-16-25(29)6/h11-20,30,34H,9-10,21H2,1-8H3,(H,35,38) |
| InChIKey | SDDFDRRPPAGBNA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|