C24H28N2O3 — CID 71470493
N-[4-tert-butyl-2,5-dideuterio-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]-2-deuterio-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 71470493) has the molecular formula C24H28N2O3 and a molecular weight of 404.57 g/mol. Its IUPAC name is N-[4-tert-butyl-2,5-dideuterio-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]-2-deuterio-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[4-tert-butyl-2,5-dideuterio-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]-2-deuterio-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 71470493 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | N-[4-tert-butyl-2,5-dideuterio-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-3-hydroxyphenyl]-2-deuterio-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | [2H]c1[nH]c2ccccc2c(=O)c1C(=O)Nc1c([2H])c(O)c(C(C)(C)C)c([2H])c1C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C24H28N2O3/c1-23(2,3)16-11-17(24(4,5)6)20(27)12-19(16)26-22(29)15-13-25-18-10-8-7-9-14(18)21(15)28/h7-13,27H,1-6H3,(H,25,28)(H,26,29)/i1D3,2D3,3D3,11D,12D,13D |
| InChIKey | PURKAOJPTOLRMP-HQEXPILSSA-N |
| XLogP | 5.08 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |