C24H26N8O6S — CID 71472663
(Z)-[(6R,7R)-2-carboxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methoxyimino-oxido-(4-pyrimidin-2-ylpiperazin-1-yl)azanium (PubChem CID 71472663) has the molecular formula C24H26N8O6S and a molecular weight of 554.59 g/mol. Its IUPAC name is (Z)-[(6R,7R)-2-carboxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methoxyimino-oxido-(4-pyrimidin-2-ylpiperazin-1-yl)azanium.
| Compound Name | (Z)-[(6R,7R)-2-carboxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methoxyimino-oxido-(4-pyrimidin-2-ylpiperazin-1-yl)azanium |
|---|---|
| PubChem CID | 71472663 |
| Molecular Formula | C24H26N8O6S |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | (Z)-[(6R,7R)-2-carboxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methoxyimino-oxido-(4-pyrimidin-2-ylpiperazin-1-yl)azanium |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)O)=C(CO/N=[N+](\[O-])N3CCN(c4ncccn4)CC3)CS[C@H]12 |
| InChI | InChI=1S/C24H26N8O6S/c33-18(13-16-5-2-1-3-6-16)27-19-21(34)31-20(23(35)36)17(15-39-22(19)31)14-38-28-32(37)30-11-9-29(10-12-30)24-25-7-4-8-26-24/h1-8,19,22H,9-15H2,(H,27,33)(H,35,36)/b32-28-/t19-,22-/m1/s1 |
| InChIKey | BIYDWCNKQKPPHA-DGOKAKCASA-N |
| XLogP | 0.39 |
| TPSA | 166.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|