C20H24KN5O6S — CID 71489476
potassium (6R,7R)-3-[[(Z)-[diethylamino(oxido)azaniumylidene]amino]oxymethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 71489476) has the molecular formula C20H24KN5O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is potassium (6R,7R)-3-[[(Z)-[diethylamino(oxido)azaniumylidene]amino]oxymethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | potassium (6R,7R)-3-[[(Z)-[diethylamino(oxido)azaniumylidene]amino]oxymethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 71489476 |
| Molecular Formula | C20H24KN5O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | potassium (6R,7R)-3-[[(Z)-[diethylamino(oxido)azaniumylidene]amino]oxymethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCN(CC)/[N+]([O-])=N/OCC1=C(C(=O)[O-])N2C(=O)[C@@H](NC(=O)Cc3ccccc3)[C@H]2SC1.[K+] |
| InChI | InChI=1S/C20H25N5O6S.K/c1-3-23(4-2)25(30)22-31-11-14-12-32-19-16(18(27)24(19)17(14)20(28)29)21-15(26)10-13-8-6-5-7-9-13;/h5-9,16,19H,3-4,10-12H2,1-2H3,(H,21,26)(H,28,29);/q;+1/p-1/b25-22-;/t16-,19-;/m1./s1 |
| InChIKey | JZGBWZICHJQWBU-MIDVJLGCSA-M |
| XLogP | -3.21 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|