C13H18O3 — CID 71472885
(3aR,7S,8aR)-6-ethenyl-3-(hydroxymethyl)-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 71472885) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3aR,7S,8aR)-6-ethenyl-3-(hydroxymethyl)-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | (3aR,7S,8aR)-6-ethenyl-3-(hydroxymethyl)-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 71472885 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3aR,7S,8aR)-6-ethenyl-3-(hydroxymethyl)-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | C=CC1=CC[C@@H]2C(CO)C(=O)O[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C13H18O3/c1-3-9-4-5-10-11(7-14)13(15)16-12(10)6-8(9)2/h3-4,8,10-12,14H,1,5-7H2,2H3/t8-,10+,11?,12+/m0/s1 |
| InChIKey | BEECBSIGACGMBE-QAPQIBMHSA-N |
| XLogP | 1.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |