C34H52N2O5 — CID 71473707
methyl (1S,4aR,5S)-5-[(3S)-5-[2-[4-(3-methoxyphenyl)piperazin-1-yl]acetyl]oxy-3-methylpentyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 71473707) has the molecular formula C34H52N2O5 and a molecular weight of 568.80 g/mol. Its IUPAC name is methyl (1S,4aR,5S)-5-[(3S)-5-[2-[4-(3-methoxyphenyl)piperazin-1-yl]acetyl]oxy-3-methylpentyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S)-5-[(3S)-5-[2-[4-(3-methoxyphenyl)piperazin-1-yl]acetyl]oxy-3-methylpentyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 71473707 |
| Molecular Formula | C34H52N2O5 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.39 |
| IUPAC Name | methyl (1S,4aR,5S)-5-[(3S)-5-[2-[4-(3-methoxyphenyl)piperazin-1-yl]acetyl]oxy-3-methylpentyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CC[C@H](C)CCOC(=O)CN1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C34H52N2O5/c1-25(11-13-29-26(2)12-14-30-33(29,3)16-8-17-34(30,4)32(38)40-6)15-22-41-31(37)24-35-18-20-36(21-19-35)27-9-7-10-28(23-27)39-5/h7,9-10,23,25,29-30H,2,8,11-22,24H2,1,3-6H3/t25-,29-,30?,33+,34-/m0/s1 |
| InChIKey | MGJVPVDDLGZEKT-AOGVRTSMSA-N |
| XLogP | 6.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|