C25H31N3O3 — CID 71474724
tert-butyl 20-methoxy-18-methyl-3,13,19-triazatetracyclo[15.3.1.02,10.04,9]henicosa-1(20),2(10),4,6,8,17(21),18-heptaene-3-carboxylate (PubChem CID 71474724) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl 20-methoxy-18-methyl-3,13,19-triazatetracyclo[15.3.1.02,10.04,9]henicosa-1(20),2(10),4,6,8,17(21),18-heptaene-3-carboxylate.
| Compound Name | tert-butyl 20-methoxy-18-methyl-3,13,19-triazatetracyclo[15.3.1.02,10.04,9]henicosa-1(20),2(10),4,6,8,17(21),18-heptaene-3-carboxylate |
|---|---|
| PubChem CID | 71474724 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl 20-methoxy-18-methyl-3,13,19-triazatetracyclo[15.3.1.02,10.04,9]henicosa-1(20),2(10),4,6,8,17(21),18-heptaene-3-carboxylate |
| SMILES | COc1nc(C)c2cc1-c1c(c3ccccc3n1C(=O)OC(C)(C)C)CCNCCC2 |
| InChI | InChI=1S/C25H31N3O3/c1-16-17-9-8-13-26-14-12-19-18-10-6-7-11-21(18)28(24(29)31-25(2,3)4)22(19)20(15-17)23(27-16)30-5/h6-7,10-11,15,26H,8-9,12-14H2,1-5H3 |
| InChIKey | FIEJBIMLLWTITQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |