C20H29BN4O21P3 — CID 71474797
CID 71474797 (PubChem CID 71474797) has the molecular formula C20H29BN4O21P3 and a molecular weight of 765.19 g/mol.
| Compound Name | CID 71474797 |
|---|---|
| PubChem CID | 71474797 |
| Molecular Formula | C20H29BN4O21P3 |
| Molecular Weight | 765.19 g/mol |
| Exact Mass | 765.06 |
| IUPAC Name | — |
| SMILES | COc1cn([C@@H]2O[C@H](CO[P@@](O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cc(OC)c(=O)[nH]c4=O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O.[B] |
| InChI | InChI=1S/C20H29N4O21P3.B/c1-38-7-3-23(19(31)21-15(7)29)17-13(27)11(25)9(42-17)5-40-46(33)44-48(36,37)45-47(34,35)41-6-10-12(26)14(28)18(43-10)24-4-8(39-2)16(30)22-20(24)32;/h3-4,9-14,17-18,25-28,33H,5-6H2,1-2H3,(H,34,35)(H,36,37)(H,21,29,31)(H,22,30,32);/t9-,10-,11-,12-,13-,14-,17-,18-,46-;/m1./s1 |
| InChIKey | FXZHHQUYQOSGQW-LPAPLEQDSA-N |
| XLogP | -4.55 |
| TPSA | 359.31 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.19 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|