C25H21F2N3O4 — CID 71479016
8-[(2,3-difluorophenyl)methoxy]-N-[(2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 71479016) has the molecular formula C25H21F2N3O4 and a molecular weight of 465.46 g/mol. Its IUPAC name is 8-[(2,3-difluorophenyl)methoxy]-N-[(2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 8-[(2,3-difluorophenyl)methoxy]-N-[(2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71479016 |
| Molecular Formula | C25H21F2N3O4 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 8-[(2,3-difluorophenyl)methoxy]-N-[(2S,3S)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2c(OCc3cccc(F)c3F)cccn2c1C(=O)NC1c2ccccc2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H21F2N3O4/c1-13-21(25(33)29-20-15-7-2-3-8-16(15)22(31)23(20)32)30-11-5-10-18(24(30)28-13)34-12-14-6-4-9-17(26)19(14)27/h2-11,20,22-23,31-32H,12H2,1H3,(H,29,33)/t20?,22-,23-/m0/s1 |
| InChIKey | ZUXQRVNFXHXKDV-FALYVICWSA-N |
| XLogP | 3.38 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |