C19H38O4Si — CID 71479760
ethyl (1R,2R,4S,5S,6R)-5-hydroxy-2,4,6-trimethyl-2-(triethylsilyloxymethyl)cyclohexane-1-carboxylate (PubChem CID 71479760) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is ethyl (1R,2R,4S,5S,6R)-5-hydroxy-2,4,6-trimethyl-2-(triethylsilyloxymethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2R,4S,5S,6R)-5-hydroxy-2,4,6-trimethyl-2-(triethylsilyloxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71479760 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | ethyl (1R,2R,4S,5S,6R)-5-hydroxy-2,4,6-trimethyl-2-(triethylsilyloxymethyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C)[C@@H](O)[C@@H](C)C[C@@]1(C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H38O4Si/c1-8-22-18(21)16-15(6)17(20)14(5)12-19(16,7)13-23-24(9-2,10-3)11-4/h14-17,20H,8-13H2,1-7H3/t14-,15+,16-,17-,19-/m0/s1 |
| InChIKey | DSEPOSDJIZBQKX-OREBXVKISA-N |
| XLogP | 4.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|