C15H26O4 — CID 71479854
tert-butyl 2-[(1S,5R)-5-[(1R,2R)-1,3-dihydroxy-2-methylpropyl]cyclopent-2-en-1-yl]acetate (PubChem CID 71479854) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5R)-5-[(1R,2R)-1,3-dihydroxy-2-methylpropyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1S,5R)-5-[(1R,2R)-1,3-dihydroxy-2-methylpropyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 71479854 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl 2-[(1S,5R)-5-[(1R,2R)-1,3-dihydroxy-2-methylpropyl]cyclopent-2-en-1-yl]acetate |
| SMILES | C[C@H](CO)[C@H](O)[C@@H]1CC=C[C@@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26O4/c1-10(9-16)14(18)12-7-5-6-11(12)8-13(17)19-15(2,3)4/h5-6,10-12,14,16,18H,7-9H2,1-4H3/t10-,11-,12-,14+/m1/s1 |
| InChIKey | CUJCUGZMDMVPGM-BYNQJWBRSA-N |
| XLogP | 1.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|