C25H21N3O2 — CID 71480454
N-cyclohexyl-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaene-10-carboxamide (PubChem CID 71480454) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-cyclohexyl-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaene-10-carboxamide.
| Compound Name | N-cyclohexyl-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaene-10-carboxamide |
|---|---|
| PubChem CID | 71480454 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-cyclohexyl-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaene-10-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc2c3ccccc3n3c(=O)c4ccccc4c(n1)c23 |
| InChI | InChI=1S/C25H21N3O2/c29-24(26-15-8-2-1-3-9-15)20-14-19-16-10-6-7-13-21(16)28-23(19)22(27-20)17-11-4-5-12-18(17)25(28)30/h4-7,10-15H,1-3,8-9H2,(H,26,29) |
| InChIKey | MRCGCRRIMURUJP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|