C21H19NO6S — CID 7148140
4-methyl-N-[7-(5-methylfuran-2-carbonyl)-2,3-dihydro-1,4-benzodioxin-6-yl]benzenesulfonamide (PubChem CID 7148140) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is 4-methyl-N-[7-(5-methylfuran-2-carbonyl)-2,3-dihydro-1,4-benzodioxin-6-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[7-(5-methylfuran-2-carbonyl)-2,3-dihydro-1,4-benzodioxin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 7148140 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-methyl-N-[7-(5-methylfuran-2-carbonyl)-2,3-dihydro-1,4-benzodioxin-6-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc3c(cc2C(=O)c2ccc(C)o2)OCCO3)cc1 |
| InChI | InChI=1S/C21H19NO6S/c1-13-3-6-15(7-4-13)29(24,25)22-17-12-20-19(26-9-10-27-20)11-16(17)21(23)18-8-5-14(2)28-18/h3-8,11-12,22H,9-10H2,1-2H3 |
| InChIKey | WGGBZCOOSYXGSB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|