About 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+)
2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) (PubChem CID 71481446) has the molecular formula C9H19N3O4Pt
and a molecular weight of 428.35 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+).
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) |
| PubChem CID | 71481446 |
| Molecular Formula | C9H19N3O4Pt |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) |
| SMILES | CN(C)CCC(C(=O)[O-])C(=O)[O-].NCCN.[Pt+2] |
| InChI | InChI=1S/C7H13NO4.C2H8N2.Pt/c1-8(2)4-3-5(6(9)10)7(11)12;3-1-2-4;/h5H,3-4H2,1-2H3,(H,9,10)(H,11,12);1-4H2;/q;;+2/p-2 |
| InChIKey | BPRIBQSFSOHRHN-UHFFFAOYSA-L |
| XLogP | -4.04 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+)?
The IUPAC name of 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) (CID 71481446) is 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+).
What is the SMILES notation for 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+)?
The canonical SMILES for 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) is CN(C)CCC(C(=O)[O-])C(=O)[O-].NCCN.[Pt+2].
What is the InChIKey of 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+)?
The InChIKey is BPRIBQSFSOHRHN-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H13NO4.C2H8N2.Pt/c1-8(2)4-3-5(6(9)10)7(11)12;3-1-2-4;/h5H,3-4H2,1-2H3,(H,9,10)(H,11,12);1-4H2;/q;;+2/p-2.
What are the key properties of 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+)?
2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) has a molecular weight of 428.35 g/mol, XLogP of -4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethyl]propanedioate;ethane-1,2-diamine;platinum(2+) is sourced from PubChem (CID 71481446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).