C21H22NO3+ — CID 71482162
4-[2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-ylidene]morpholin-4-ium (PubChem CID 71482162) has the molecular formula C21H22NO3+ and a molecular weight of 336.41 g/mol. Its IUPAC name is 4-[2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-ylidene]morpholin-4-ium.
| Compound Name | 4-[2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-ylidene]morpholin-4-ium |
|---|---|
| PubChem CID | 71482162 |
| Molecular Formula | C21H22NO3+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-ylidene]morpholin-4-ium |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)c2=[N+]2CCOCC2)cc1 |
| InChI | InChI=1S/C21H22NO3/c1-23-17-7-3-15(4-8-17)19-20(16-5-9-18(24-2)10-6-16)21(19)22-11-13-25-14-12-22/h3-10H,11-14H2,1-2H3/q+1 |
| InChIKey | NZGGWAURJWQNHP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|