C27H34N4OS — CID 71482204
4,6-diamino-3-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 71482204) has the molecular formula C27H34N4OS and a molecular weight of 462.66 g/mol. Its IUPAC name is 4,6-diamino-3-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]thieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4,6-diamino-3-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]thieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 71482204 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4,6-diamino-3-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2c1csc2nc(N)c(C#N)c(N)c12 |
| InChI | InChI=1S/C27H34N4OS/c1-26-9-7-15(32)11-14(26)3-4-16-19-5-6-20(27(19,2)10-8-21(16)26)18-13-33-25-22(18)23(29)17(12-28)24(30)31-25/h3,13,15-16,19-21,32H,4-11H2,1-2H3,(H4,29,30,31)/t15-,16-,19-,20+,21-,26-,27-/m0/s1 |
| InChIKey | SUPAGKDDHGXPJQ-ZFHWUFJKSA-N |
| XLogP | 5.74 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|