About (1-methylpiperidin-4-yl) 3-fluorobenzoate
(1-methylpiperidin-4-yl) 3-fluorobenzoate (PubChem CID 714836) has the molecular formula C13H16FNO2
and a molecular weight of 237.27 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 3-fluorobenzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 3-fluorobenzoate |
| PubChem CID | 714836 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (1-methylpiperidin-4-yl) 3-fluorobenzoate |
| SMILES | CN1CCC(OC(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C13H16FNO2/c1-15-7-5-12(6-8-15)17-13(16)10-3-2-4-11(14)9-10/h2-4,9,12H,5-8H2,1H3 |
| InChIKey | ZFURYJWOGQNUPY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 3-fluorobenzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 3-fluorobenzoate (CID 714836) is (1-methylpiperidin-4-yl) 3-fluorobenzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 3-fluorobenzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 3-fluorobenzoate is CN1CCC(OC(=O)c2cccc(F)c2)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) 3-fluorobenzoate?
The InChIKey is ZFURYJWOGQNUPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO2/c1-15-7-5-12(6-8-15)17-13(16)10-3-2-4-11(14)9-10/h2-4,9,12H,5-8H2,1H3.
What are the key properties of (1-methylpiperidin-4-yl) 3-fluorobenzoate?
(1-methylpiperidin-4-yl) 3-fluorobenzoate has a molecular weight of 237.27 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 3-fluorobenzoate is sourced from PubChem (CID 714836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).