C22H20FN3O2 — CID 71483949
2-[3-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-(3-fluorophenyl)acetamide (PubChem CID 71483949) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[3-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[3-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 71483949 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[3-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-N-(3-fluorophenyl)acetamide |
| SMILES | Nc1ccccc1NC(=O)Cc1cccc(CC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C22H20FN3O2/c23-17-7-4-8-18(14-17)25-21(27)12-15-5-3-6-16(11-15)13-22(28)26-20-10-2-1-9-19(20)24/h1-11,14H,12-13,24H2,(H,25,27)(H,26,28) |
| InChIKey | OWYYNOPZLXBNJJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|