About 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid
2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid (PubChem CID 71484852) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid.
Analyze 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid?
The IUPAC name of 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid (CID 71484852) is 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid.
What is the SMILES notation for 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid?
The canonical SMILES for 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid is CC(=O)O[C@H]1COC=C[C@@H]1CC(=O)O.
What is the InChIKey of 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid?
The InChIKey is NQAQCTRNWVYGDJ-SFYZADRCSA-N. The full InChI is InChI=1S/C9H12O5/c1-6(10)14-8-5-13-3-2-7(8)4-9(11)12/h2-3,7-8H,4-5H2,1H3,(H,11,12)/t7-,8+/m1/s1.
What are the key properties of 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid?
2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid has a molecular weight of 200.19 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-acetyloxy-3,4-dihydro-2H-pyran-4-yl]acetic acid is sourced from PubChem (CID 71484852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).