C10H9N3O3 — CID 71484992
6-[(E)-[5-(hydroxymethyl)furan-2-yl]methylideneamino]-1H-pyrimidin-2-one (PubChem CID 71484992) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 6-[(E)-[5-(hydroxymethyl)furan-2-yl]methylideneamino]-1H-pyrimidin-2-one.
| Compound Name | 6-[(E)-[5-(hydroxymethyl)furan-2-yl]methylideneamino]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 71484992 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 6-[(E)-[5-(hydroxymethyl)furan-2-yl]methylideneamino]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc(/N=C/c2ccc(CO)o2)[nH]1 |
| InChI | InChI=1S/C10H9N3O3/c14-6-8-2-1-7(16-8)5-12-9-3-4-11-10(15)13-9/h1-5,14H,6H2,(H,11,13,15)/b12-5+ |
| InChIKey | WIRNSCMNYAJEMR-LFYBBSHMSA-N |
| XLogP | 0.61 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|