About [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol
[5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol (PubChem CID 153317965) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol |
| PubChem CID | 153317965 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol |
| SMILES | CC(C)(C)/C=C/c1ccc(CO)o1 |
| InChI | InChI=1S/C11H16O2/c1-11(2,3)7-6-9-4-5-10(8-12)13-9/h4-7,12H,8H2,1-3H3/b7-6+ |
| InChIKey | AZJDZOKBFUMZTH-VOTSOKGWSA-N |
| XLogP | 2.83 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol?
The IUPAC name of [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol (CID 153317965) is [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol?
The canonical SMILES for [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol is CC(C)(C)/C=C/c1ccc(CO)o1.
What is the InChIKey of [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol?
The InChIKey is AZJDZOKBFUMZTH-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H16O2/c1-11(2,3)7-6-9-4-5-10(8-12)13-9/h4-7,12H,8H2,1-3H3/b7-6+.
What are the key properties of [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol?
[5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol has a molecular weight of 180.25 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(E)-3,3-dimethylbut-1-enyl]furan-2-yl]methanol is sourced from PubChem (CID 153317965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).