C30H46O5 — CID 71488555
(2R,4S,5R,7R,10S,13R)-2,7,10-trihydroxy-4,5,9,9,13,20,20-heptamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one (PubChem CID 71488555) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (2R,4S,5R,7R,10S,13R)-2,7,10-trihydroxy-4,5,9,9,13,20,20-heptamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one.
| Compound Name | (2R,4S,5R,7R,10S,13R)-2,7,10-trihydroxy-4,5,9,9,13,20,20-heptamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
|---|---|
| PubChem CID | 71488555 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (2R,4S,5R,7R,10S,13R)-2,7,10-trihydroxy-4,5,9,9,13,20,20-heptamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
| SMILES | CC1(C)CC2C3=CCC4[C@@]5(C)CC[C@H](O)C(C)(C)C5[C@H](O)C[C@@]4(C)[C@]3(C)C[C@@H](O)C23CC1OC3=O |
| InChI | InChI=1S/C30H46O5/c1-25(2)12-17-16-8-9-19-27(5)11-10-20(32)26(3,4)23(27)18(31)13-29(19,7)28(16,6)14-21(33)30(17)15-22(25)35-24(30)34/h8,17-23,31-33H,9-15H2,1-7H3/t17?,18-,19?,20+,21-,22?,23?,27-,28-,29-,30?/m1/s1 |
| InChIKey | XOYVRWLTBKGHTQ-TXQPJBAXSA-N |
| XLogP | 4.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|