C30H46O5 — CID 11755175
(1R,2R,4S,5R,10S,13R,18S,20S,21S)-2,10-dihydroxy-20-(hydroxymethyl)-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one (PubChem CID 11755175) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (1R,2R,4S,5R,10S,13R,18S,20S,21S)-2,10-dihydroxy-20-(hydroxymethyl)-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one.
| Compound Name | (1R,2R,4S,5R,10S,13R,18S,20S,21S)-2,10-dihydroxy-20-(hydroxymethyl)-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
|---|---|
| PubChem CID | 11755175 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (1R,2R,4S,5R,10S,13R,18S,20S,21S)-2,10-dihydroxy-20-(hydroxymethyl)-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
| SMILES | CC1(C)C2CC[C@]3(C)C(CC=C4[C@@H]5C[C@@](C)(CO)[C@@H]6C[C@]5(C(=O)O6)[C@H](O)C[C@]43C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C30H46O5/c1-25(2)19-9-12-28(5)20(27(19,4)11-10-21(25)32)8-7-17-18-13-26(3,16-31)23-15-30(18,24(34)35-23)22(33)14-29(17,28)6/h7,18-23,31-33H,8-16H2,1-6H3/t18-,19?,20?,21-,22+,23-,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | JGMFHIWOTSMYOU-ZURGAFRASA-N |
| XLogP | 4.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|