C30H46O6 — CID 162936301
(1S,2R,3R,4S,6S,10S,11R,14S,16S,19R,20S,21R)-2,3,14-trihydroxy-4-(hydroxymethyl)-4,11,15,15,19,20-hexamethyl-22-oxahexacyclo[19.2.1.01,6.07,20.010,19.011,16]tetracos-7-en-23-one (PubChem CID 162936301) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is (1S,2R,3R,4S,6S,10S,11R,14S,16S,19R,20S,21R)-2,3,14-trihydroxy-4-(hydroxymethyl)-4,11,15,15,19,20-hexamethyl-22-oxahexacyclo[19.2.1.01,6.07,20.010,19.011,16]tetracos-7-en-23-one.
| Compound Name | (1S,2R,3R,4S,6S,10S,11R,14S,16S,19R,20S,21R)-2,3,14-trihydroxy-4-(hydroxymethyl)-4,11,15,15,19,20-hexamethyl-22-oxahexacyclo[19.2.1.01,6.07,20.010,19.011,16]tetracos-7-en-23-one |
|---|---|
| PubChem CID | 162936301 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | (1S,2R,3R,4S,6S,10S,11R,14S,16S,19R,20S,21R)-2,3,14-trihydroxy-4-(hydroxymethyl)-4,11,15,15,19,20-hexamethyl-22-oxahexacyclo[19.2.1.01,6.07,20.010,19.011,16]tetracos-7-en-23-one |
| SMILES | CC1(C)[C@H]2CC[C@]3(C)[C@@H](CC=C4[C@@H]5C[C@@](C)(CO)[C@@H](O)[C@H](O)[C@]56C[C@@H](OC6=O)[C@]43C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C30H46O6/c1-25(2)18-9-12-28(5)19(27(18,4)11-10-20(25)32)8-7-16-17-13-26(3,15-31)22(33)23(34)30(17)14-21(29(16,28)6)36-24(30)35/h7,17-23,31-34H,8-15H2,1-6H3/t17-,18+,19-,20-,21+,22-,23-,26-,27-,28+,29-,30-/m0/s1 |
| InChIKey | WBRUZQYGCIWBHD-XBRNWFHESA-N |
| XLogP | 3.60 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|