About 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline
5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline (PubChem CID 71493213) has the molecular formula C17H19FN2O4S
and a molecular weight of 366.41 g/mol. Its IUPAC name is 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline.
Molecular Properties
| Compound Name | 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline |
| PubChem CID | 71493213 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)(C)Oc3ccc(F)cc32)cc1N |
| InChI | InChI=1S/C17H19FN2O4S/c1-17(2)10-20(14-8-11(18)4-6-16(14)24-17)25(21,22)12-5-7-15(23-3)13(19)9-12/h4-9H,10,19H2,1-3H3 |
| InChIKey | QBNIXOWYTRFJBM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline?
The IUPAC name of 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline (CID 71493213) is 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline.
What is the SMILES notation for 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline?
The canonical SMILES for 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline is COc1ccc(S(=O)(=O)N2CC(C)(C)Oc3ccc(F)cc32)cc1N.
What is the InChIKey of 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline?
The InChIKey is QBNIXOWYTRFJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O4S/c1-17(2)10-20(14-8-11(18)4-6-16(14)24-17)25(21,22)12-5-7-15(23-3)13(19)9-12/h4-9H,10,19H2,1-3H3.
What are the key properties of 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline?
5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline has a molecular weight of 366.41 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-fluoro-2,2-dimethyl-3H-1,4-benzoxazin-4-yl)sulfonyl]-2-methoxyaniline is sourced from PubChem (CID 71493213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).