C23H25F2N3S — CID 71494081
N'-[4-[[4-(2,5-difluoro-4-methylphenyl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71494081) has the molecular formula C23H25F2N3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N'-[4-[[4-(2,5-difluoro-4-methylphenyl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[4-(2,5-difluoro-4-methylphenyl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71494081 |
| Molecular Formula | C23H25F2N3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N'-[4-[[4-(2,5-difluoro-4-methylphenyl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(-c3cc(F)c(C)cc3F)cs2)cc1C |
| InChI | InChI=1S/C23H25F2N3S/c1-6-28(5)13-26-21-9-14(2)17(7-16(21)4)10-23-27-22(12-29-23)18-11-19(24)15(3)8-20(18)25/h7-9,11-13H,6,10H2,1-5H3/b26-13+ |
| InChIKey | JNHWOXFBAVRQIF-LGJNPRDNSA-N |
| XLogP | 6.22 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|