C21H17FN2O2 — CID 71496034
1-(4-fluorophenyl)-3-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]urea (PubChem CID 71496034) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]urea |
|---|---|
| PubChem CID | 71496034 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(/C=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H17FN2O2/c22-17-7-11-19(12-8-17)24-21(26)23-18-9-3-15(4-10-18)1-2-16-5-13-20(25)14-6-16/h1-14,25H,(H2,23,24,26)/b2-1+ |
| InChIKey | IFFVKNJBUIYXOO-OWOJBTEDSA-N |
| XLogP | 5.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|