C28H28N4O — CID 71496725
2-[4-(3-methylpiperidin-1-yl)but-2-ynyl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazol-3-one (PubChem CID 71496725) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[4-(3-methylpiperidin-1-yl)but-2-ynyl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazol-3-one.
| Compound Name | 2-[4-(3-methylpiperidin-1-yl)but-2-ynyl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 71496725 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-[4-(3-methylpiperidin-1-yl)but-2-ynyl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazol-3-one |
| SMILES | CC1CCCN(CC#CCn2nc(-c3ccccc3)n(-c3cccc4ccccc34)c2=O)C1 |
| InChI | InChI=1S/C28H28N4O/c1-22-11-10-19-30(21-22)18-7-8-20-31-28(33)32(27(29-31)24-13-3-2-4-14-24)26-17-9-15-23-12-5-6-16-25(23)26/h2-6,9,12-17,22H,10-11,18-21H2,1H3 |
| InChIKey | RYXLZHRKNFTDBS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|