C23H28N2O8 — CID 71499047
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenyl-5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carbonyl)oxypyrrolidine-1,2-dicarboxylate (PubChem CID 71499047) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenyl-5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carbonyl)oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenyl-5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carbonyl)oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71499047 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenyl-5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carbonyl)oxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=Cc1c2c(cc3c1OCO3)CN(C(=O)O[C@@H]1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1)C2 |
| InChI | InChI=1S/C23H28N2O8/c1-6-15-16-11-24(9-13(16)7-18-19(15)31-12-30-18)21(27)32-14-8-17(20(26)29-5)25(10-14)22(28)33-23(2,3)4/h6-7,14,17H,1,8-12H2,2-5H3/t14-,17+/m1/s1 |
| InChIKey | TXZRAKVSOBHMJO-PBHICJAKSA-N |
| XLogP | 3.06 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|