C6H7NO3 — CID 71502138
(4Z)-4-(methoxymethylidene)-2-methyl-1,3-oxazol-5-one (PubChem CID 71502138) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is (4Z)-4-(methoxymethylidene)-2-methyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-(methoxymethylidene)-2-methyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71502138 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | (4Z)-4-(methoxymethylidene)-2-methyl-1,3-oxazol-5-one |
| SMILES | CO/C=C1\N=C(C)OC1=O |
| InChI | InChI=1S/C6H7NO3/c1-4-7-5(3-9-2)6(8)10-4/h3H,1-2H3/b5-3- |
| InChIKey | KTDDLXMFYULVPW-HYXAFXHYSA-N |
| XLogP | 0.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|