C8H9NO2 — CID 59109513
4-but-2-enylidene-2-methyl-1,3-oxazol-5-one (PubChem CID 59109513) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 4-but-2-enylidene-2-methyl-1,3-oxazol-5-one.
| Compound Name | 4-but-2-enylidene-2-methyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 59109513 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 4-but-2-enylidene-2-methyl-1,3-oxazol-5-one |
| SMILES | CC=CC=C1N=C(C)OC1=O |
| InChI | InChI=1S/C8H9NO2/c1-3-4-5-7-8(10)11-6(2)9-7/h3-5H,1-2H3 |
| InChIKey | BFDPHNICCSCRGM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|