C13H10BrNO2 — CID 3253339
2-(3-bromophenyl)-4-but-2-enylidene-1,3-oxazol-5-one (PubChem CID 3253339) has the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-but-2-enylidene-1,3-oxazol-5-one.
| Compound Name | 2-(3-bromophenyl)-4-but-2-enylidene-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3253339 |
| Molecular Formula | C13H10BrNO2 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-(3-bromophenyl)-4-but-2-enylidene-1,3-oxazol-5-one |
| SMILES | CC=CC=C1N=C(c2cccc(Br)c2)OC1=O |
| InChI | InChI=1S/C13H10BrNO2/c1-2-3-7-11-13(16)17-12(15-11)9-5-4-6-10(14)8-9/h2-8H,1H3 |
| InChIKey | AOMSWKFIDOUWCG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|