C13H5BrCl2N2O2S — CID 76870476
2-(3-bromophenyl)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 76870476) has the molecular formula C13H5BrCl2N2O2S and a molecular weight of 404.07 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(3-bromophenyl)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 76870476 |
| Molecular Formula | C13H5BrCl2N2O2S |
| Molecular Weight | 404.07 g/mol |
| Exact Mass | 401.86 |
| IUPAC Name | 2-(3-bromophenyl)-4-[(2,4-dichloro-1,3-thiazol-5-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc(Br)c2)=NC1=Cc1sc(Cl)nc1Cl |
| InChI | InChI=1S/C13H5BrCl2N2O2S/c14-7-3-1-2-6(4-7)11-17-8(12(19)20-11)5-9-10(15)18-13(16)21-9/h1-5H |
| InChIKey | ZRYNQFHSZMDXBO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.07 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|