C15H19NO5 — CID 71503814
ethyl 5-acetyloxy-2-benzyl-1,2-oxazolidine-3-carboxylate (PubChem CID 71503814) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 5-acetyloxy-2-benzyl-1,2-oxazolidine-3-carboxylate.
| Compound Name | ethyl 5-acetyloxy-2-benzyl-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 71503814 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl 5-acetyloxy-2-benzyl-1,2-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CC(OC(C)=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO5/c1-3-19-15(18)13-9-14(20-11(2)17)21-16(13)10-12-7-5-4-6-8-12/h4-8,13-14H,3,9-10H2,1-2H3 |
| InChIKey | WNUCIMDQBRYUCD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |