diphenylmethanamine;2,2,2-trifluoroacetic acid

C15H14F3NO2 — CID 71505318

IUPACdiphenylmethanamine;2,2,2-trifluoroacetic acid
SMILESNC(c1ccccc1)c1ccccc1.O=C(O)C(F)(F)F
InChIInChI=1S/C13H13N.C2HF3O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-2(4,5)1(6)7/h1-10,13H,14H2;(H,6,7)
InChIKeyUDHCIVKGUHNVGN-UHFFFAOYSA-N
MW297.28 g/mol
LogP3.37
Rot. Bonds2

About diphenylmethanamine;2,2,2-trifluoroacetic acid

diphenylmethanamine;2,2,2-trifluoroacetic acid (PubChem CID 71505318) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is diphenylmethanamine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namediphenylmethanamine;2,2,2-trifluoroacetic acid
PubChem CID71505318
Molecular FormulaC15H14F3NO2
Molecular Weight297.28 g/mol
Exact Mass297.10
IUPAC Namediphenylmethanamine;2,2,2-trifluoroacetic acid
SMILESNC(c1ccccc1)c1ccccc1.O=C(O)C(F)(F)F
InChIInChI=1S/C13H13N.C2HF3O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-2(4,5)1(6)7/h1-10,13H,14H2;(H,6,7)
InChIKeyUDHCIVKGUHNVGN-UHFFFAOYSA-N
XLogP3.37
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.28
LogP ≤ 53.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze diphenylmethanamine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diphenylmethanamine;2,2,2-trifluoroacetic acid?
The IUPAC name of diphenylmethanamine;2,2,2-trifluoroacetic acid (CID 71505318) is diphenylmethanamine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for diphenylmethanamine;2,2,2-trifluoroacetic acid?
The canonical SMILES for diphenylmethanamine;2,2,2-trifluoroacetic acid is NC(c1ccccc1)c1ccccc1.O=C(O)C(F)(F)F.
What is the InChIKey of diphenylmethanamine;2,2,2-trifluoroacetic acid?
The InChIKey is UDHCIVKGUHNVGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C2HF3O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-2(4,5)1(6)7/h1-10,13H,14H2;(H,6,7).
What are the key properties of diphenylmethanamine;2,2,2-trifluoroacetic acid?
diphenylmethanamine;2,2,2-trifluoroacetic acid has a molecular weight of 297.28 g/mol, XLogP of 3.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 71505318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).