C15H14F3NO2 — CID 71505318
diphenylmethanamine;2,2,2-trifluoroacetic acid (PubChem CID 71505318) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is diphenylmethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | diphenylmethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71505318 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | diphenylmethanamine;2,2,2-trifluoroacetic acid |
| SMILES | NC(c1ccccc1)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13N.C2HF3O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-2(4,5)1(6)7/h1-10,13H,14H2;(H,6,7) |
| InChIKey | UDHCIVKGUHNVGN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |